C25H26N2O6S2 — CID 4758039
butyl 4-[[2-[5-[(3,4-dimethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetyl]amino]benzoate (PubChem CID 4758039) has the molecular formula C25H26N2O6S2 and a molecular weight of 514.63 g/mol. Its IUPAC name is butyl 4-[[2-[5-[(3,4-dimethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetyl]amino]benzoate.
| Compound Name | butyl 4-[[2-[5-[(3,4-dimethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 4758039 |
| Molecular Formula | C25H26N2O6S2 |
| Molecular Weight | 514.63 g/mol |
| Exact Mass | 514.12 |
| IUPAC Name | butyl 4-[[2-[5-[(3,4-dimethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1ccc(NC(=O)CN2C(=O)C(=Cc3ccc(OC)c(OC)c3)SC2=S)cc1 |
| InChI | InChI=1S/C25H26N2O6S2/c1-4-5-12-33-24(30)17-7-9-18(10-8-17)26-22(28)15-27-23(29)21(35-25(27)34)14-16-6-11-19(31-2)20(13-16)32-3/h6-11,13-14H,4-5,12,15H2,1-3H3,(H,26,28) |
| InChIKey | JTCROQVPUDXURB-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.63 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|