C26H28BrN3O4S2 — CID 6201166
2-(diethylamino)ethyl 4-[3-[(5E)-5-[(3-bromophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]benzoate (PubChem CID 6201166) has the molecular formula C26H28BrN3O4S2 and a molecular weight of 590.57 g/mol. Its IUPAC name is 2-(diethylamino)ethyl 4-[3-[(5E)-5-[(3-bromophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]benzoate.
| Compound Name | 2-(diethylamino)ethyl 4-[3-[(5E)-5-[(3-bromophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]benzoate |
|---|---|
| PubChem CID | 6201166 |
| Molecular Formula | C26H28BrN3O4S2 |
| Molecular Weight | 590.57 g/mol |
| Exact Mass | 589.07 |
| IUPAC Name | 2-(diethylamino)ethyl 4-[3-[(5E)-5-[(3-bromophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]benzoate |
| SMILES | CCN(CC)CCOC(=O)c1ccc(NC(=O)CCN2C(=O)/C(=C\c3cccc(Br)c3)SC2=S)cc1 |
| InChI | InChI=1S/C26H28BrN3O4S2/c1-3-29(4-2)14-15-34-25(33)19-8-10-21(11-9-19)28-23(31)12-13-30-24(32)22(36-26(30)35)17-18-6-5-7-20(27)16-18/h5-11,16-17H,3-4,12-15H2,1-2H3,(H,28,31)/b22-17+ |
| InChIKey | JBHDDMLWAUHTPH-OQKWZONESA-N |
| XLogP | 5.18 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.57 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|