C26H29FN4O3S2 — CID 6200957
N-[2-(diethylamino)ethyl]-4-[3-[(5Z)-5-[(4-fluorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]benzamide (PubChem CID 6200957) has the molecular formula C26H29FN4O3S2 and a molecular weight of 528.68 g/mol. Its IUPAC name is N-[2-(diethylamino)ethyl]-4-[3-[(5Z)-5-[(4-fluorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]benzamide.
| Compound Name | N-[2-(diethylamino)ethyl]-4-[3-[(5Z)-5-[(4-fluorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]benzamide |
|---|---|
| PubChem CID | 6200957 |
| Molecular Formula | C26H29FN4O3S2 |
| Molecular Weight | 528.68 g/mol |
| Exact Mass | 528.17 |
| IUPAC Name | N-[2-(diethylamino)ethyl]-4-[3-[(5Z)-5-[(4-fluorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoylamino]benzamide |
| SMILES | CCN(CC)CCNC(=O)c1ccc(NC(=O)CCN2C(=O)/C(=C/c3ccc(F)cc3)SC2=S)cc1 |
| InChI | InChI=1S/C26H29FN4O3S2/c1-3-30(4-2)16-14-28-24(33)19-7-11-21(12-8-19)29-23(32)13-15-31-25(34)22(36-26(31)35)17-18-5-9-20(27)10-6-18/h5-12,17H,3-4,13-16H2,1-2H3,(H,28,33)(H,29,32)/b22-17- |
| InChIKey | UARIPOQXVOCBRC-XLNRJJMWSA-N |
| XLogP | 4.13 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.68 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|