C24H28N4O4 — CID 2406200
N-[2-(diethylamino)ethyl]-4-[3-(1,3-dioxoisoindol-2-yl)propanoylamino]benzamide (PubChem CID 2406200) has the molecular formula C24H28N4O4 and a molecular weight of 436.51 g/mol. Its IUPAC name is N-[2-(diethylamino)ethyl]-4-[3-(1,3-dioxoisoindol-2-yl)propanoylamino]benzamide.
| Compound Name | N-[2-(diethylamino)ethyl]-4-[3-(1,3-dioxoisoindol-2-yl)propanoylamino]benzamide |
|---|---|
| PubChem CID | 2406200 |
| Molecular Formula | C24H28N4O4 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.21 |
| IUPAC Name | N-[2-(diethylamino)ethyl]-4-[3-(1,3-dioxoisoindol-2-yl)propanoylamino]benzamide |
| SMILES | CCN(CC)CCNC(=O)c1ccc(NC(=O)CCN2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C24H28N4O4/c1-3-27(4-2)16-14-25-22(30)17-9-11-18(12-10-17)26-21(29)13-15-28-23(31)19-7-5-6-8-20(19)24(28)32/h5-12H,3-4,13-16H2,1-2H3,(H,25,30)(H,26,29) |
| InChIKey | KJFLTEFWTRGDFA-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|