C29H40N4O3 — CID 56944101
N-[2-(diethylamino)ethyl]-4-[8-(1,3-dioxoisoindol-2-yl)octylamino]benzamide (PubChem CID 56944101) has the molecular formula C29H40N4O3 and a molecular weight of 492.66 g/mol. Its IUPAC name is N-[2-(diethylamino)ethyl]-4-[8-(1,3-dioxoisoindol-2-yl)octylamino]benzamide.
| Compound Name | N-[2-(diethylamino)ethyl]-4-[8-(1,3-dioxoisoindol-2-yl)octylamino]benzamide |
|---|---|
| PubChem CID | 56944101 |
| Molecular Formula | C29H40N4O3 |
| Molecular Weight | 492.66 g/mol |
| Exact Mass | 492.31 |
| IUPAC Name | N-[2-(diethylamino)ethyl]-4-[8-(1,3-dioxoisoindol-2-yl)octylamino]benzamide |
| SMILES | CCN(CC)CCNC(=O)c1ccc(NCCCCCCCCN2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C29H40N4O3/c1-3-32(4-2)22-20-31-27(34)23-15-17-24(18-16-23)30-19-11-7-5-6-8-12-21-33-28(35)25-13-9-10-14-26(25)29(33)36/h9-10,13-18,30H,3-8,11-12,19-22H2,1-2H3,(H,31,34) |
| InChIKey | HXDHELWESLGCRB-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.66 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|