C17H30Cl2N4O2 — CID 119827825
4-[(2-amino-2-methylpropanoyl)amino]-N-[2-(diethylamino)ethyl]benzamide;dihydrochloride (PubChem CID 119827825) has the molecular formula C17H30Cl2N4O2 and a molecular weight of 393.36 g/mol. Its IUPAC name is 4-[(2-amino-2-methylpropanoyl)amino]-N-[2-(diethylamino)ethyl]benzamide;dihydrochloride.
| Compound Name | 4-[(2-amino-2-methylpropanoyl)amino]-N-[2-(diethylamino)ethyl]benzamide;dihydrochloride |
|---|---|
| PubChem CID | 119827825 |
| Molecular Formula | C17H30Cl2N4O2 |
| Molecular Weight | 393.36 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | 4-[(2-amino-2-methylpropanoyl)amino]-N-[2-(diethylamino)ethyl]benzamide;dihydrochloride |
| SMILES | CCN(CC)CCNC(=O)c1ccc(NC(=O)C(C)(C)N)cc1.Cl.Cl |
| InChI | InChI=1S/C17H28N4O2.2ClH/c1-5-21(6-2)12-11-19-15(22)13-7-9-14(10-8-13)20-16(23)17(3,4)18;;/h7-10H,5-6,11-12,18H2,1-4H3,(H,19,22)(H,20,23);2*1H |
| InChIKey | PKSZFUURLNGCTP-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.36 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |