C23H25N5O6 — CID 110839390
N-[2-(diethylamino)ethyl]-4-[[2-(4-nitro-1,3-dioxoisoindol-2-yl)acetyl]amino]benzamide (PubChem CID 110839390) has the molecular formula C23H25N5O6 and a molecular weight of 467.48 g/mol. Its IUPAC name is N-[2-(diethylamino)ethyl]-4-[[2-(4-nitro-1,3-dioxoisoindol-2-yl)acetyl]amino]benzamide.
| Compound Name | N-[2-(diethylamino)ethyl]-4-[[2-(4-nitro-1,3-dioxoisoindol-2-yl)acetyl]amino]benzamide |
|---|---|
| PubChem CID | 110839390 |
| Molecular Formula | C23H25N5O6 |
| Molecular Weight | 467.48 g/mol |
| Exact Mass | 467.18 |
| IUPAC Name | N-[2-(diethylamino)ethyl]-4-[[2-(4-nitro-1,3-dioxoisoindol-2-yl)acetyl]amino]benzamide |
| SMILES | CCN(CC)CCNC(=O)c1ccc(NC(=O)CN2C(=O)c3cccc([N+](=O)[O-])c3C2=O)cc1 |
| InChI | InChI=1S/C23H25N5O6/c1-3-26(4-2)13-12-24-21(30)15-8-10-16(11-9-15)25-19(29)14-27-22(31)17-6-5-7-18(28(33)34)20(17)23(27)32/h5-11H,3-4,12-14H2,1-2H3,(H,24,30)(H,25,29) |
| InChIKey | RVKWFAOAHKWBAB-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 141.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.48 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|