C26H36N4O3 — CID 110839377
4-(6-benzamidohexanoylamino)-N-[2-(diethylamino)ethyl]benzamide (PubChem CID 110839377) has the molecular formula C26H36N4O3 and a molecular weight of 452.60 g/mol. Its IUPAC name is 4-(6-benzamidohexanoylamino)-N-[2-(diethylamino)ethyl]benzamide.
| Compound Name | 4-(6-benzamidohexanoylamino)-N-[2-(diethylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 110839377 |
| Molecular Formula | C26H36N4O3 |
| Molecular Weight | 452.60 g/mol |
| Exact Mass | 452.28 |
| IUPAC Name | 4-(6-benzamidohexanoylamino)-N-[2-(diethylamino)ethyl]benzamide |
| SMILES | CCN(CC)CCNC(=O)c1ccc(NC(=O)CCCCCNC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C26H36N4O3/c1-3-30(4-2)20-19-28-26(33)22-14-16-23(17-15-22)29-24(31)13-9-6-10-18-27-25(32)21-11-7-5-8-12-21/h5,7-8,11-12,14-17H,3-4,6,9-10,13,18-20H2,1-2H3,(H,27,32)(H,28,33)(H,29,31) |
| InChIKey | NZIBYXAQRQTEAL-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.60 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|