C18H27N3O4 — CID 108797576
methyl 4-[4-[2-(diethylamino)ethylcarbamoyl]anilino]-4-oxobutanoate (PubChem CID 108797576) has the molecular formula C18H27N3O4 and a molecular weight of 349.43 g/mol. Its IUPAC name is methyl 4-[4-[2-(diethylamino)ethylcarbamoyl]anilino]-4-oxobutanoate.
| Compound Name | methyl 4-[4-[2-(diethylamino)ethylcarbamoyl]anilino]-4-oxobutanoate |
|---|---|
| PubChem CID | 108797576 |
| Molecular Formula | C18H27N3O4 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.20 |
| IUPAC Name | methyl 4-[4-[2-(diethylamino)ethylcarbamoyl]anilino]-4-oxobutanoate |
| SMILES | CCN(CC)CCNC(=O)c1ccc(NC(=O)CCC(=O)OC)cc1 |
| InChI | InChI=1S/C18H27N3O4/c1-4-21(5-2)13-12-19-18(24)14-6-8-15(9-7-14)20-16(22)10-11-17(23)25-3/h6-9H,4-5,10-13H2,1-3H3,(H,19,24)(H,20,22) |
| InChIKey | ZRNCBAQQRDPIQJ-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |