C20H27N5O4 — CID 108788763
N-[2-(diethylamino)ethyl]-4-[3-(2,4-dioxopyrimidin-1-yl)propanoylamino]benzamide (PubChem CID 108788763) has the molecular formula C20H27N5O4 and a molecular weight of 401.47 g/mol. Its IUPAC name is N-[2-(diethylamino)ethyl]-4-[3-(2,4-dioxopyrimidin-1-yl)propanoylamino]benzamide.
| Compound Name | N-[2-(diethylamino)ethyl]-4-[3-(2,4-dioxopyrimidin-1-yl)propanoylamino]benzamide |
|---|---|
| PubChem CID | 108788763 |
| Molecular Formula | C20H27N5O4 |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.21 |
| IUPAC Name | N-[2-(diethylamino)ethyl]-4-[3-(2,4-dioxopyrimidin-1-yl)propanoylamino]benzamide |
| SMILES | CCN(CC)CCNC(=O)c1ccc(NC(=O)CCn2ccc(=O)[nH]c2=O)cc1 |
| InChI | InChI=1S/C20H27N5O4/c1-3-24(4-2)14-11-21-19(28)15-5-7-16(8-6-15)22-17(26)9-12-25-13-10-18(27)23-20(25)29/h5-8,10,13H,3-4,9,11-12,14H2,1-2H3,(H,21,28)(H,22,26)(H,23,27,29) |
| InChIKey | KKGXDSWHLGXDKL-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 116.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |