C17H22N4O3 — CID 35569669
N-[4-(diethylamino)phenyl]-3-(2,4-dioxopyrimidin-1-yl)propanamide (PubChem CID 35569669) has the molecular formula C17H22N4O3 and a molecular weight of 330.39 g/mol. Its IUPAC name is N-[4-(diethylamino)phenyl]-3-(2,4-dioxopyrimidin-1-yl)propanamide.
| Compound Name | N-[4-(diethylamino)phenyl]-3-(2,4-dioxopyrimidin-1-yl)propanamide |
|---|---|
| PubChem CID | 35569669 |
| Molecular Formula | C17H22N4O3 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | N-[4-(diethylamino)phenyl]-3-(2,4-dioxopyrimidin-1-yl)propanamide |
| SMILES | CCN(CC)c1ccc(NC(=O)CCn2ccc(=O)[nH]c2=O)cc1 |
| InChI | InChI=1S/C17H22N4O3/c1-3-20(4-2)14-7-5-13(6-8-14)18-15(22)9-11-21-12-10-16(23)19-17(21)24/h5-8,10,12H,3-4,9,11H2,1-2H3,(H,18,22)(H,19,23,24) |
| InChIKey | PVZWWYALFBHQRZ-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 87.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|