C13H10Cl3N3O3 — CID 108788791
3-(2,4-dioxopyrimidin-1-yl)-N-(2,4,6-trichlorophenyl)propanamide (PubChem CID 108788791) has the molecular formula C13H10Cl3N3O3 and a molecular weight of 362.60 g/mol. Its IUPAC name is 3-(2,4-dioxopyrimidin-1-yl)-N-(2,4,6-trichlorophenyl)propanamide.
| Compound Name | 3-(2,4-dioxopyrimidin-1-yl)-N-(2,4,6-trichlorophenyl)propanamide |
|---|---|
| PubChem CID | 108788791 |
| Molecular Formula | C13H10Cl3N3O3 |
| Molecular Weight | 362.60 g/mol |
| Exact Mass | 360.98 |
| IUPAC Name | 3-(2,4-dioxopyrimidin-1-yl)-N-(2,4,6-trichlorophenyl)propanamide |
| SMILES | O=C(CCn1ccc(=O)[nH]c1=O)Nc1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C13H10Cl3N3O3/c14-7-5-8(15)12(9(16)6-7)17-10(20)1-3-19-4-2-11(21)18-13(19)22/h2,4-6H,1,3H2,(H,17,20)(H,18,21,22) |
| InChIKey | GNWRUMHIXPNFPS-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 83.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.60 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |