C13H13N3O4 — CID 108788631
3-(2,4-dioxopyrimidin-1-yl)-N-(4-hydroxyphenyl)propanamide (PubChem CID 108788631) has the molecular formula C13H13N3O4 and a molecular weight of 275.26 g/mol. Its IUPAC name is 3-(2,4-dioxopyrimidin-1-yl)-N-(4-hydroxyphenyl)propanamide.
| Compound Name | 3-(2,4-dioxopyrimidin-1-yl)-N-(4-hydroxyphenyl)propanamide |
|---|---|
| PubChem CID | 108788631 |
| Molecular Formula | C13H13N3O4 |
| Molecular Weight | 275.26 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | 3-(2,4-dioxopyrimidin-1-yl)-N-(4-hydroxyphenyl)propanamide |
| SMILES | O=C(CCn1ccc(=O)[nH]c1=O)Nc1ccc(O)cc1 |
| InChI | InChI=1S/C13H13N3O4/c17-10-3-1-9(2-4-10)14-11(18)5-7-16-8-6-12(19)15-13(16)20/h1-4,6,8,17H,5,7H2,(H,14,18)(H,15,19,20) |
| InChIKey | MKECOVAVTQFUGL-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 104.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.26 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|