C16H17N3O5 — CID 108788630
ethyl 2-[3-(2,4-dioxopyrimidin-1-yl)propanoylamino]benzoate (PubChem CID 108788630) has the molecular formula C16H17N3O5 and a molecular weight of 331.33 g/mol. Its IUPAC name is ethyl 2-[3-(2,4-dioxopyrimidin-1-yl)propanoylamino]benzoate.
| Compound Name | ethyl 2-[3-(2,4-dioxopyrimidin-1-yl)propanoylamino]benzoate |
|---|---|
| PubChem CID | 108788630 |
| Molecular Formula | C16H17N3O5 |
| Molecular Weight | 331.33 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | ethyl 2-[3-(2,4-dioxopyrimidin-1-yl)propanoylamino]benzoate |
| SMILES | CCOC(=O)c1ccccc1NC(=O)CCn1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C16H17N3O5/c1-2-24-15(22)11-5-3-4-6-12(11)17-13(20)7-9-19-10-8-14(21)18-16(19)23/h3-6,8,10H,2,7,9H2,1H3,(H,17,20)(H,18,21,23) |
| InChIKey | FPGOZQMECDSOFA-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 110.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.33 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |