C16H17N3O6 — CID 90480546
[2-(2-methoxyanilino)-2-oxoethyl] 3-(2,4-dioxopyrimidin-1-yl)propanoate (PubChem CID 90480546) has the molecular formula C16H17N3O6 and a molecular weight of 347.33 g/mol. Its IUPAC name is [2-(2-methoxyanilino)-2-oxoethyl] 3-(2,4-dioxopyrimidin-1-yl)propanoate.
| Compound Name | [2-(2-methoxyanilino)-2-oxoethyl] 3-(2,4-dioxopyrimidin-1-yl)propanoate |
|---|---|
| PubChem CID | 90480546 |
| Molecular Formula | C16H17N3O6 |
| Molecular Weight | 347.33 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | [2-(2-methoxyanilino)-2-oxoethyl] 3-(2,4-dioxopyrimidin-1-yl)propanoate |
| SMILES | COc1ccccc1NC(=O)COC(=O)CCn1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C16H17N3O6/c1-24-12-5-3-2-4-11(12)17-14(21)10-25-15(22)7-9-19-8-6-13(20)18-16(19)23/h2-6,8H,7,9-10H2,1H3,(H,17,21)(H,18,20,23) |
| InChIKey | SPBCHQNAEJLABF-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 119.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.33 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |