C16H17N3O7 — CID 9063575
[2-(2,4-dimethoxyanilino)-2-oxoethyl] 2-(2,4-dioxopyrimidin-1-yl)acetate (PubChem CID 9063575) has the molecular formula C16H17N3O7 and a molecular weight of 363.33 g/mol. Its IUPAC name is [2-(2,4-dimethoxyanilino)-2-oxoethyl] 2-(2,4-dioxopyrimidin-1-yl)acetate.
| Compound Name | [2-(2,4-dimethoxyanilino)-2-oxoethyl] 2-(2,4-dioxopyrimidin-1-yl)acetate |
|---|---|
| PubChem CID | 9063575 |
| Molecular Formula | C16H17N3O7 |
| Molecular Weight | 363.33 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | [2-(2,4-dimethoxyanilino)-2-oxoethyl] 2-(2,4-dioxopyrimidin-1-yl)acetate |
| SMILES | COc1ccc(NC(=O)COC(=O)Cn2ccc(=O)[nH]c2=O)c(OC)c1 |
| InChI | InChI=1S/C16H17N3O7/c1-24-10-3-4-11(12(7-10)25-2)17-14(21)9-26-15(22)8-19-6-5-13(20)18-16(19)23/h3-7H,8-9H2,1-2H3,(H,17,21)(H,18,20,23) |
| InChIKey | LPKDRYJJXPGRRD-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 128.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.33 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |