C14H12ClN3O5 — CID 9063517
[2-(2-chloroanilino)-2-oxoethyl] 2-(2,4-dioxopyrimidin-1-yl)acetate (PubChem CID 9063517) has the molecular formula C14H12ClN3O5 and a molecular weight of 337.72 g/mol. Its IUPAC name is [2-(2-chloroanilino)-2-oxoethyl] 2-(2,4-dioxopyrimidin-1-yl)acetate.
| Compound Name | [2-(2-chloroanilino)-2-oxoethyl] 2-(2,4-dioxopyrimidin-1-yl)acetate |
|---|---|
| PubChem CID | 9063517 |
| Molecular Formula | C14H12ClN3O5 |
| Molecular Weight | 337.72 g/mol |
| Exact Mass | 337.05 |
| IUPAC Name | [2-(2-chloroanilino)-2-oxoethyl] 2-(2,4-dioxopyrimidin-1-yl)acetate |
| SMILES | O=C(COC(=O)Cn1ccc(=O)[nH]c1=O)Nc1ccccc1Cl |
| InChI | InChI=1S/C14H12ClN3O5/c15-9-3-1-2-4-10(9)16-12(20)8-23-13(21)7-18-6-5-11(19)17-14(18)22/h1-6H,7-8H2,(H,16,20)(H,17,19,22) |
| InChIKey | SPGNPCRUOLRTPT-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 110.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.72 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |