C15H15N3O5 — CID 9063513
[2-(3-methylanilino)-2-oxoethyl] 2-(2,4-dioxopyrimidin-1-yl)acetate (PubChem CID 9063513) has the molecular formula C15H15N3O5 and a molecular weight of 317.30 g/mol. Its IUPAC name is [2-(3-methylanilino)-2-oxoethyl] 2-(2,4-dioxopyrimidin-1-yl)acetate.
| Compound Name | [2-(3-methylanilino)-2-oxoethyl] 2-(2,4-dioxopyrimidin-1-yl)acetate |
|---|---|
| PubChem CID | 9063513 |
| Molecular Formula | C15H15N3O5 |
| Molecular Weight | 317.30 g/mol |
| Exact Mass | 317.10 |
| IUPAC Name | [2-(3-methylanilino)-2-oxoethyl] 2-(2,4-dioxopyrimidin-1-yl)acetate |
| SMILES | Cc1cccc(NC(=O)COC(=O)Cn2ccc(=O)[nH]c2=O)c1 |
| InChI | InChI=1S/C15H15N3O5/c1-10-3-2-4-11(7-10)16-13(20)9-23-14(21)8-18-6-5-12(19)17-15(18)22/h2-7H,8-9H2,1H3,(H,16,20)(H,17,19,22) |
| InChIKey | HRYQBOXDUYETRI-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 110.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.30 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |