C18H21N3O5 — CID 7602163
[2-(4-butylanilino)-2-oxoethyl] 2-(2,4-dioxopyrimidin-1-yl)acetate (PubChem CID 7602163) has the molecular formula C18H21N3O5 and a molecular weight of 359.38 g/mol. Its IUPAC name is [2-(4-butylanilino)-2-oxoethyl] 2-(2,4-dioxopyrimidin-1-yl)acetate.
| Compound Name | [2-(4-butylanilino)-2-oxoethyl] 2-(2,4-dioxopyrimidin-1-yl)acetate |
|---|---|
| PubChem CID | 7602163 |
| Molecular Formula | C18H21N3O5 |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | [2-(4-butylanilino)-2-oxoethyl] 2-(2,4-dioxopyrimidin-1-yl)acetate |
| SMILES | CCCCc1ccc(NC(=O)COC(=O)Cn2ccc(=O)[nH]c2=O)cc1 |
| InChI | InChI=1S/C18H21N3O5/c1-2-3-4-13-5-7-14(8-6-13)19-16(23)12-26-17(24)11-21-10-9-15(22)20-18(21)25/h5-10H,2-4,11-12H2,1H3,(H,19,23)(H,20,22,25) |
| InChIKey | UOXPBHAUNQYJFJ-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 110.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |