C21H26N2O5 — CID 9063670
[(2S)-1-(4-hexylphenyl)-1-oxopropan-2-yl] 2-(2,4-dioxopyrimidin-1-yl)acetate (PubChem CID 9063670) has the molecular formula C21H26N2O5 and a molecular weight of 386.45 g/mol. Its IUPAC name is [(2S)-1-(4-hexylphenyl)-1-oxopropan-2-yl] 2-(2,4-dioxopyrimidin-1-yl)acetate.
| Compound Name | [(2S)-1-(4-hexylphenyl)-1-oxopropan-2-yl] 2-(2,4-dioxopyrimidin-1-yl)acetate |
|---|---|
| PubChem CID | 9063670 |
| Molecular Formula | C21H26N2O5 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | [(2S)-1-(4-hexylphenyl)-1-oxopropan-2-yl] 2-(2,4-dioxopyrimidin-1-yl)acetate |
| SMILES | CCCCCCc1ccc(C(=O)[C@H](C)OC(=O)Cn2ccc(=O)[nH]c2=O)cc1 |
| InChI | InChI=1S/C21H26N2O5/c1-3-4-5-6-7-16-8-10-17(11-9-16)20(26)15(2)28-19(25)14-23-13-12-18(24)22-21(23)27/h8-13,15H,3-7,14H2,1-2H3,(H,22,24,27)/t15-/m0/s1 |
| InChIKey | LPEVKVBDIVZEJB-HNNXBMFYSA-N |
| XLogP | 2.47 |
| TPSA | 98.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|