C17H19NO5 — CID 52889689
[(2R)-1-(4-ethylphenyl)-1-oxopropan-2-yl] 2-(2,5-dioxopyrrolidin-1-yl)acetate (PubChem CID 52889689) has the molecular formula C17H19NO5 and a molecular weight of 317.34 g/mol. Its IUPAC name is [(2R)-1-(4-ethylphenyl)-1-oxopropan-2-yl] 2-(2,5-dioxopyrrolidin-1-yl)acetate.
| Compound Name | [(2R)-1-(4-ethylphenyl)-1-oxopropan-2-yl] 2-(2,5-dioxopyrrolidin-1-yl)acetate |
|---|---|
| PubChem CID | 52889689 |
| Molecular Formula | C17H19NO5 |
| Molecular Weight | 317.34 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | [(2R)-1-(4-ethylphenyl)-1-oxopropan-2-yl] 2-(2,5-dioxopyrrolidin-1-yl)acetate |
| SMILES | CCc1ccc(C(=O)[C@@H](C)OC(=O)CN2C(=O)CCC2=O)cc1 |
| InChI | InChI=1S/C17H19NO5/c1-3-12-4-6-13(7-5-12)17(22)11(2)23-16(21)10-18-14(19)8-9-15(18)20/h4-7,11H,3,8-10H2,1-2H3/t11-/m1/s1 |
| InChIKey | WXEFSTQSGFFMGY-LLVKDONJSA-N |
| XLogP | 1.51 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.34 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|