C13H19NO6 — CID 95636366
butyl (2R)-2-[2-(2,5-dioxopyrrolidin-1-yl)acetyl]oxypropanoate (PubChem CID 95636366) has the molecular formula C13H19NO6 and a molecular weight of 285.30 g/mol. Its IUPAC name is butyl (2R)-2-[2-(2,5-dioxopyrrolidin-1-yl)acetyl]oxypropanoate.
| Compound Name | butyl (2R)-2-[2-(2,5-dioxopyrrolidin-1-yl)acetyl]oxypropanoate |
|---|---|
| PubChem CID | 95636366 |
| Molecular Formula | C13H19NO6 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | butyl (2R)-2-[2-(2,5-dioxopyrrolidin-1-yl)acetyl]oxypropanoate |
| SMILES | CCCCOC(=O)[C@@H](C)OC(=O)CN1C(=O)CCC1=O |
| InChI | InChI=1S/C13H19NO6/c1-3-4-7-19-13(18)9(2)20-12(17)8-14-10(15)5-6-11(14)16/h9H,3-8H2,1-2H3/t9-/m1/s1 |
| InChIKey | WMBNISDNBXBSPH-SECBINFHSA-N |
| XLogP | 0.41 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|