C14H21NO5S — CID 56807179
butyl 2-[3-(4-methyl-2-oxo-1,3-thiazol-3-yl)propanoyloxy]propanoate (PubChem CID 56807179) has the molecular formula C14H21NO5S and a molecular weight of 315.39 g/mol. Its IUPAC name is butyl 2-[3-(4-methyl-2-oxo-1,3-thiazol-3-yl)propanoyloxy]propanoate.
| Compound Name | butyl 2-[3-(4-methyl-2-oxo-1,3-thiazol-3-yl)propanoyloxy]propanoate |
|---|---|
| PubChem CID | 56807179 |
| Molecular Formula | C14H21NO5S |
| Molecular Weight | 315.39 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | butyl 2-[3-(4-methyl-2-oxo-1,3-thiazol-3-yl)propanoyloxy]propanoate |
| SMILES | CCCCOC(=O)C(C)OC(=O)CCn1c(C)csc1=O |
| InChI | InChI=1S/C14H21NO5S/c1-4-5-8-19-13(17)11(3)20-12(16)6-7-15-10(2)9-21-14(15)18/h9,11H,4-8H2,1-3H3 |
| InChIKey | CAFZKYKXHRRVAO-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 74.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.39 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|