C8H13NO2S — CID 43509713
3-(4-hydroxybutyl)-4-methyl-1,3-thiazol-2-one (PubChem CID 43509713) has the molecular formula C8H13NO2S and a molecular weight of 187.26 g/mol. Its IUPAC name is 3-(4-hydroxybutyl)-4-methyl-1,3-thiazol-2-one.
| Compound Name | 3-(4-hydroxybutyl)-4-methyl-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 43509713 |
| Molecular Formula | C8H13NO2S |
| Molecular Weight | 187.26 g/mol |
| Exact Mass | 187.07 |
| IUPAC Name | 3-(4-hydroxybutyl)-4-methyl-1,3-thiazol-2-one |
| SMILES | Cc1csc(=O)n1CCCCO |
| InChI | InChI=1S/C8H13NO2S/c1-7-6-12-8(11)9(7)4-2-3-5-10/h6,10H,2-5H2,1H3 |
| InChIKey | HXHXZIIMMYVGKQ-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.26 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|