C7H11NO2S — CID 43509712
3-(3-hydroxypropyl)-4-methyl-1,3-thiazol-2-one (PubChem CID 43509712) has the molecular formula C7H11NO2S and a molecular weight of 173.24 g/mol. Its IUPAC name is 3-(3-hydroxypropyl)-4-methyl-1,3-thiazol-2-one.
| Compound Name | 3-(3-hydroxypropyl)-4-methyl-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 43509712 |
| Molecular Formula | C7H11NO2S |
| Molecular Weight | 173.24 g/mol |
| Exact Mass | 173.05 |
| IUPAC Name | 3-(3-hydroxypropyl)-4-methyl-1,3-thiazol-2-one |
| SMILES | Cc1csc(=O)n1CCCO |
| InChI | InChI=1S/C7H11NO2S/c1-6-5-11-7(10)8(6)3-2-4-9/h5,9H,2-4H2,1H3 |
| InChIKey | RERCYZGXLGYYSL-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.24 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |