C32H42N2O8 — CID 67822026
[(2S)-1-butoxy-1-oxopropan-2-yl] 4-[4-[4-[(2S)-1-butoxy-1-oxopropan-2-yl]oxycarbonylphenyl]piperazin-1-yl]benzoate (PubChem CID 67822026) has the molecular formula C32H42N2O8 and a molecular weight of 582.69 g/mol. Its IUPAC name is [(2S)-1-butoxy-1-oxopropan-2-yl] 4-[4-[4-[(2S)-1-butoxy-1-oxopropan-2-yl]oxycarbonylphenyl]piperazin-1-yl]benzoate.
| Compound Name | [(2S)-1-butoxy-1-oxopropan-2-yl] 4-[4-[4-[(2S)-1-butoxy-1-oxopropan-2-yl]oxycarbonylphenyl]piperazin-1-yl]benzoate |
|---|---|
| PubChem CID | 67822026 |
| Molecular Formula | C32H42N2O8 |
| Molecular Weight | 582.69 g/mol |
| Exact Mass | 582.29 |
| IUPAC Name | [(2S)-1-butoxy-1-oxopropan-2-yl] 4-[4-[4-[(2S)-1-butoxy-1-oxopropan-2-yl]oxycarbonylphenyl]piperazin-1-yl]benzoate |
| SMILES | CCCCOC(=O)[C@H](C)OC(=O)c1ccc(N2CCN(c3ccc(C(=O)O[C@@H](C)C(=O)OCCCC)cc3)CC2)cc1 |
| InChI | InChI=1S/C32H42N2O8/c1-5-7-21-39-29(35)23(3)41-31(37)25-9-13-27(14-10-25)33-17-19-34(20-18-33)28-15-11-26(12-16-28)32(38)42-24(4)30(36)40-22-8-6-2/h9-16,23-24H,5-8,17-22H2,1-4H3/t23-,24-/m0/s1 |
| InChIKey | LQDORTBPKGLCRX-ZEQRLZLVSA-N |
| XLogP | 4.79 |
| TPSA | 111.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.69 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|