C32H46N2O4 — CID 18655697
heptan-2-yl 4-[4-[4-[(2S)-heptan-2-yl]oxycarbonylphenyl]piperazin-1-yl]benzoate (PubChem CID 18655697) has the molecular formula C32H46N2O4 and a molecular weight of 522.73 g/mol. Its IUPAC name is heptan-2-yl 4-[4-[4-[(2S)-heptan-2-yl]oxycarbonylphenyl]piperazin-1-yl]benzoate.
| Compound Name | heptan-2-yl 4-[4-[4-[(2S)-heptan-2-yl]oxycarbonylphenyl]piperazin-1-yl]benzoate |
|---|---|
| PubChem CID | 18655697 |
| Molecular Formula | C32H46N2O4 |
| Molecular Weight | 522.73 g/mol |
| Exact Mass | 522.35 |
| IUPAC Name | heptan-2-yl 4-[4-[4-[(2S)-heptan-2-yl]oxycarbonylphenyl]piperazin-1-yl]benzoate |
| SMILES | CCCCCC(C)OC(=O)c1ccc(N2CCN(c3ccc(C(=O)O[C@@H](C)CCCCC)cc3)CC2)cc1 |
| InChI | InChI=1S/C32H46N2O4/c1-5-7-9-11-25(3)37-31(35)27-13-17-29(18-14-27)33-21-23-34(24-22-33)30-19-15-28(16-20-30)32(36)38-26(4)12-10-8-6-2/h13-20,25-26H,5-12,21-24H2,1-4H3/t25-,26?/m0/s1 |
| InChIKey | LETLTTRPOIDYAS-PMCHYTPCSA-N |
| XLogP | 7.26 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.73 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|