C34H52N4O4 — CID 18655689
[(2R)-nonan-2-yl] 6-[4-[5-[(2R)-nonan-2-yl]oxycarbonyl-2-pyridinyl]piperazin-1-yl]pyridine-3-carboxylate (PubChem CID 18655689) has the molecular formula C34H52N4O4 and a molecular weight of 580.81 g/mol. Its IUPAC name is [(2R)-nonan-2-yl] 6-[4-[5-[(2R)-nonan-2-yl]oxycarbonyl-2-pyridinyl]piperazin-1-yl]pyridine-3-carboxylate.
| Compound Name | [(2R)-nonan-2-yl] 6-[4-[5-[(2R)-nonan-2-yl]oxycarbonyl-2-pyridinyl]piperazin-1-yl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 18655689 |
| Molecular Formula | C34H52N4O4 |
| Molecular Weight | 580.81 g/mol |
| Exact Mass | 580.40 |
| IUPAC Name | [(2R)-nonan-2-yl] 6-[4-[5-[(2R)-nonan-2-yl]oxycarbonyl-2-pyridinyl]piperazin-1-yl]pyridine-3-carboxylate |
| SMILES | CCCCCCC[C@@H](C)OC(=O)c1ccc(N2CCN(c3ccc(C(=O)O[C@H](C)CCCCCCC)cn3)CC2)nc1 |
| InChI | InChI=1S/C34H52N4O4/c1-5-7-9-11-13-15-27(3)41-33(39)29-17-19-31(35-25-29)37-21-23-38(24-22-37)32-20-18-30(26-36-32)34(40)42-28(4)16-14-12-10-8-6-2/h17-20,25-28H,5-16,21-24H2,1-4H3/t27-,28-/m1/s1 |
| InChIKey | FQSULRKHRLUHEQ-VSGBNLITSA-N |
| XLogP | 7.61 |
| TPSA | 84.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.81 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|