C34H46N4O6 — CID 58835425
4-[2-[4-(4-acetylphenyl)piperazin-1-yl]propanoyloxy]butyl 2-[4-(4-acetylphenyl)piperazin-1-yl]propanoate (PubChem CID 58835425) has the molecular formula C34H46N4O6 and a molecular weight of 606.76 g/mol. Its IUPAC name is 4-[2-[4-(4-acetylphenyl)piperazin-1-yl]propanoyloxy]butyl 2-[4-(4-acetylphenyl)piperazin-1-yl]propanoate.
| Compound Name | 4-[2-[4-(4-acetylphenyl)piperazin-1-yl]propanoyloxy]butyl 2-[4-(4-acetylphenyl)piperazin-1-yl]propanoate |
|---|---|
| PubChem CID | 58835425 |
| Molecular Formula | C34H46N4O6 |
| Molecular Weight | 606.76 g/mol |
| Exact Mass | 606.34 |
| IUPAC Name | 4-[2-[4-(4-acetylphenyl)piperazin-1-yl]propanoyloxy]butyl 2-[4-(4-acetylphenyl)piperazin-1-yl]propanoate |
| SMILES | CC(=O)c1ccc(N2CCN(C(C)C(=O)OCCCCOC(=O)C(C)N3CCN(c4ccc(C(C)=O)cc4)CC3)CC2)cc1 |
| InChI | InChI=1S/C34H46N4O6/c1-25(35-15-19-37(20-16-35)31-11-7-29(8-12-31)27(3)39)33(41)43-23-5-6-24-44-34(42)26(2)36-17-21-38(22-18-36)32-13-9-30(10-14-32)28(4)40/h7-14,25-26H,5-6,15-24H2,1-4H3 |
| InChIKey | BLMKMONKAIMXJU-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 99.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.76 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|