C22H34N4O2 — CID 57442577
2-[4-(4-acetylphenyl)piperazin-1-yl]-1-(4-butan-2-ylpiperazin-1-yl)ethanone (PubChem CID 57442577) has the molecular formula C22H34N4O2 and a molecular weight of 386.54 g/mol. Its IUPAC name is 2-[4-(4-acetylphenyl)piperazin-1-yl]-1-(4-butan-2-ylpiperazin-1-yl)ethanone.
| Compound Name | 2-[4-(4-acetylphenyl)piperazin-1-yl]-1-(4-butan-2-ylpiperazin-1-yl)ethanone |
|---|---|
| PubChem CID | 57442577 |
| Molecular Formula | C22H34N4O2 |
| Molecular Weight | 386.54 g/mol |
| Exact Mass | 386.27 |
| IUPAC Name | 2-[4-(4-acetylphenyl)piperazin-1-yl]-1-(4-butan-2-ylpiperazin-1-yl)ethanone |
| SMILES | CCC(C)N1CCN(C(=O)CN2CCN(c3ccc(C(C)=O)cc3)CC2)CC1 |
| InChI | InChI=1S/C22H34N4O2/c1-4-18(2)24-13-15-26(16-14-24)22(28)17-23-9-11-25(12-10-23)21-7-5-20(6-8-21)19(3)27/h5-8,18H,4,9-17H2,1-3H3 |
| InChIKey | VKVANYLBXIUIFK-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 47.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.54 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |