C21H33ClN4O — CID 57442936
1-(4-butan-2-ylpiperazin-1-yl)-2-[4-(4-chloro-3-methylphenyl)piperazin-1-yl]ethanone (PubChem CID 57442936) has the molecular formula C21H33ClN4O and a molecular weight of 392.98 g/mol. Its IUPAC name is 1-(4-butan-2-ylpiperazin-1-yl)-2-[4-(4-chloro-3-methylphenyl)piperazin-1-yl]ethanone.
| Compound Name | 1-(4-butan-2-ylpiperazin-1-yl)-2-[4-(4-chloro-3-methylphenyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 57442936 |
| Molecular Formula | C21H33ClN4O |
| Molecular Weight | 392.98 g/mol |
| Exact Mass | 392.23 |
| IUPAC Name | 1-(4-butan-2-ylpiperazin-1-yl)-2-[4-(4-chloro-3-methylphenyl)piperazin-1-yl]ethanone |
| SMILES | CCC(C)N1CCN(C(=O)CN2CCN(c3ccc(Cl)c(C)c3)CC2)CC1 |
| InChI | InChI=1S/C21H33ClN4O/c1-4-18(3)24-11-13-26(14-12-24)21(27)16-23-7-9-25(10-8-23)19-5-6-20(22)17(2)15-19/h5-6,15,18H,4,7-14,16H2,1-3H3 |
| InChIKey | DVJVLYGVJPCTLZ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 30.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.98 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |