C22H26Cl2N4O — CID 122195196
1,2-bis[4-(4-chlorophenyl)piperazin-1-yl]ethanone (PubChem CID 122195196) has the molecular formula C22H26Cl2N4O and a molecular weight of 433.38 g/mol. Its IUPAC name is 1,2-bis[4-(4-chlorophenyl)piperazin-1-yl]ethanone.
| Compound Name | 1,2-bis[4-(4-chlorophenyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 122195196 |
| Molecular Formula | C22H26Cl2N4O |
| Molecular Weight | 433.38 g/mol |
| Exact Mass | 432.15 |
| IUPAC Name | 1,2-bis[4-(4-chlorophenyl)piperazin-1-yl]ethanone |
| SMILES | O=C(CN1CCN(c2ccc(Cl)cc2)CC1)N1CCN(c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C22H26Cl2N4O/c23-18-1-5-20(6-2-18)26-11-9-25(10-12-26)17-22(29)28-15-13-27(14-16-28)21-7-3-19(24)4-8-21/h1-8H,9-17H2 |
| InChIKey | UCMVIQKRUDAZSM-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 30.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.38 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |