C21H28ClN5O — CID 90495308
1-[4-(4-chlorophenyl)piperazin-1-yl]-2-[4-(pyrazol-1-ylmethyl)piperidin-1-yl]ethanone (PubChem CID 90495308) has the molecular formula C21H28ClN5O and a molecular weight of 401.94 g/mol. Its IUPAC name is 1-[4-(4-chlorophenyl)piperazin-1-yl]-2-[4-(pyrazol-1-ylmethyl)piperidin-1-yl]ethanone.
| Compound Name | 1-[4-(4-chlorophenyl)piperazin-1-yl]-2-[4-(pyrazol-1-ylmethyl)piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 90495308 |
| Molecular Formula | C21H28ClN5O |
| Molecular Weight | 401.94 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | 1-[4-(4-chlorophenyl)piperazin-1-yl]-2-[4-(pyrazol-1-ylmethyl)piperidin-1-yl]ethanone |
| SMILES | O=C(CN1CCC(Cn2cccn2)CC1)N1CCN(c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C21H28ClN5O/c22-19-2-4-20(5-3-19)25-12-14-26(15-13-25)21(28)17-24-10-6-18(7-11-24)16-27-9-1-8-23-27/h1-5,8-9,18H,6-7,10-17H2 |
| InChIKey | RATKGJNZYFLGLL-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 44.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.94 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |