C21H29N5O2 — CID 92612922
1-[4-(4-methoxyphenyl)piperazin-1-yl]-2-[(2R)-2-(pyrazol-1-ylmethyl)pyrrolidin-1-yl]ethanone (PubChem CID 92612922) has the molecular formula C21H29N5O2 and a molecular weight of 383.50 g/mol. Its IUPAC name is 1-[4-(4-methoxyphenyl)piperazin-1-yl]-2-[(2R)-2-(pyrazol-1-ylmethyl)pyrrolidin-1-yl]ethanone.
| Compound Name | 1-[4-(4-methoxyphenyl)piperazin-1-yl]-2-[(2R)-2-(pyrazol-1-ylmethyl)pyrrolidin-1-yl]ethanone |
|---|---|
| PubChem CID | 92612922 |
| Molecular Formula | C21H29N5O2 |
| Molecular Weight | 383.50 g/mol |
| Exact Mass | 383.23 |
| IUPAC Name | 1-[4-(4-methoxyphenyl)piperazin-1-yl]-2-[(2R)-2-(pyrazol-1-ylmethyl)pyrrolidin-1-yl]ethanone |
| SMILES | COc1ccc(N2CCN(C(=O)CN3CCC[C@@H]3Cn3cccn3)CC2)cc1 |
| InChI | InChI=1S/C21H29N5O2/c1-28-20-7-5-18(6-8-20)23-12-14-24(15-13-23)21(27)17-25-10-2-4-19(25)16-26-11-3-9-22-26/h3,5-9,11,19H,2,4,10,12-17H2,1H3/t19-/m1/s1 |
| InChIKey | PUXLEVJQIRAKCX-LJQANCHMSA-N |
| XLogP | 1.70 |
| TPSA | 53.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.50 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|