C22H32N4O2 — CID 92633834
2-[1-[2-(azetidin-1-yl)-2-oxoethyl]piperidin-4-yl]-1-(4-phenylpiperazin-1-yl)ethanone (PubChem CID 92633834) has the molecular formula C22H32N4O2 and a molecular weight of 384.52 g/mol. Its IUPAC name is 2-[1-[2-(azetidin-1-yl)-2-oxoethyl]piperidin-4-yl]-1-(4-phenylpiperazin-1-yl)ethanone.
| Compound Name | 2-[1-[2-(azetidin-1-yl)-2-oxoethyl]piperidin-4-yl]-1-(4-phenylpiperazin-1-yl)ethanone |
|---|---|
| PubChem CID | 92633834 |
| Molecular Formula | C22H32N4O2 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.25 |
| IUPAC Name | 2-[1-[2-(azetidin-1-yl)-2-oxoethyl]piperidin-4-yl]-1-(4-phenylpiperazin-1-yl)ethanone |
| SMILES | O=C(CC1CCN(CC(=O)N2CCC2)CC1)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C22H32N4O2/c27-21(26-15-13-24(14-16-26)20-5-2-1-3-6-20)17-19-7-11-23(12-8-19)18-22(28)25-9-4-10-25/h1-3,5-6,19H,4,7-18H2 |
| InChIKey | FURAWNWBSOZMHS-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 47.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |