C15H18N4O3 — CID 110703260
4-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]pyrazolidine-3,5-dione (PubChem CID 110703260) has the molecular formula C15H18N4O3 and a molecular weight of 302.33 g/mol. Its IUPAC name is 4-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]pyrazolidine-3,5-dione.
| Compound Name | 4-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]pyrazolidine-3,5-dione |
|---|---|
| PubChem CID | 110703260 |
| Molecular Formula | C15H18N4O3 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | 4-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]pyrazolidine-3,5-dione |
| SMILES | O=C1NNC(=O)C1CC(=O)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C15H18N4O3/c20-13(10-12-14(21)16-17-15(12)22)19-8-6-18(7-9-19)11-4-2-1-3-5-11/h1-5,12H,6-10H2,(H,16,21)(H,17,22) |
| InChIKey | MJDMOHDISGGACL-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_B(12)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|