C20H29N4O2+ — CID 11875095
(3R,4aS,8aR)-3-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]-3,4,4a,5,6,7,8,8a-octahydro-1H-quinoxalin-4-ium-2-one (PubChem CID 11875095) has the molecular formula C20H29N4O2+ and a molecular weight of 357.48 g/mol. Its IUPAC name is (3R,4aS,8aR)-3-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]-3,4,4a,5,6,7,8,8a-octahydro-1H-quinoxalin-4-ium-2-one.
| Compound Name | (3R,4aS,8aR)-3-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]-3,4,4a,5,6,7,8,8a-octahydro-1H-quinoxalin-4-ium-2-one |
|---|---|
| PubChem CID | 11875095 |
| Molecular Formula | C20H29N4O2+ |
| Molecular Weight | 357.48 g/mol |
| Exact Mass | 357.23 |
| IUPAC Name | (3R,4aS,8aR)-3-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]-3,4,4a,5,6,7,8,8a-octahydro-1H-quinoxalin-4-ium-2-one |
| SMILES | O=C1N[C@@H]2CCCC[C@@H]2[NH2+][C@@H]1CC(=O)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C20H28N4O2/c25-19(14-18-20(26)22-17-9-5-4-8-16(17)21-18)24-12-10-23(11-13-24)15-6-2-1-3-7-15/h1-3,6-7,16-18,21H,4-5,8-14H2,(H,22,26)/p+1/t16-,17+,18+/m0/s1 |
| InChIKey | UWBQHZKARFQCON-RCCFBDPRSA-O |
| XLogP | 0.10 |
| TPSA | 69.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.48 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |