C21H32N4O2+2 — CID 11892208
(3S,4aS,8aR)-3-[2-(4-benzylpiperazin-4-ium-1-yl)-2-oxoethyl]-3,4,4a,5,6,7,8,8a-octahydro-1H-quinoxalin-4-ium-2-one (PubChem CID 11892208) has the molecular formula C21H32N4O2+2 and a molecular weight of 372.51 g/mol. Its IUPAC name is (3S,4aS,8aR)-3-[2-(4-benzylpiperazin-4-ium-1-yl)-2-oxoethyl]-3,4,4a,5,6,7,8,8a-octahydro-1H-quinoxalin-4-ium-2-one.
| Compound Name | (3S,4aS,8aR)-3-[2-(4-benzylpiperazin-4-ium-1-yl)-2-oxoethyl]-3,4,4a,5,6,7,8,8a-octahydro-1H-quinoxalin-4-ium-2-one |
|---|---|
| PubChem CID | 11892208 |
| Molecular Formula | C21H32N4O2+2 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.25 |
| IUPAC Name | (3S,4aS,8aR)-3-[2-(4-benzylpiperazin-4-ium-1-yl)-2-oxoethyl]-3,4,4a,5,6,7,8,8a-octahydro-1H-quinoxalin-4-ium-2-one |
| SMILES | O=C1N[C@@H]2CCCC[C@@H]2[NH2+][C@H]1CC(=O)N1CC[NH+](Cc2ccccc2)CC1 |
| InChI | InChI=1S/C21H30N4O2/c26-20(14-19-21(27)23-18-9-5-4-8-17(18)22-19)25-12-10-24(11-13-25)15-16-6-2-1-3-7-16/h1-3,6-7,17-19,22H,4-5,8-15H2,(H,23,27)/p+2/t17-,18+,19-/m0/s1 |
| InChIKey | ROUPVEVEXKIBOB-OTWHNJEPSA-P |
| XLogP | -1.32 |
| TPSA | 70.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | -1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |