C23H30N3O2+ — CID 6987007
[5-(4-benzylpiperazin-4-ium-1-carbonyl)-1H-pyrrol-3-yl]-cyclohexylmethanone (PubChem CID 6987007) has the molecular formula C23H30N3O2+ and a molecular weight of 380.51 g/mol. Its IUPAC name is [5-(4-benzylpiperazin-4-ium-1-carbonyl)-1H-pyrrol-3-yl]-cyclohexylmethanone.
| Compound Name | [5-(4-benzylpiperazin-4-ium-1-carbonyl)-1H-pyrrol-3-yl]-cyclohexylmethanone |
|---|---|
| PubChem CID | 6987007 |
| Molecular Formula | C23H30N3O2+ |
| Molecular Weight | 380.51 g/mol |
| Exact Mass | 380.23 |
| IUPAC Name | [5-(4-benzylpiperazin-4-ium-1-carbonyl)-1H-pyrrol-3-yl]-cyclohexylmethanone |
| SMILES | O=C(c1c[nH]c(C(=O)N2CC[NH+](Cc3ccccc3)CC2)c1)C1CCCCC1 |
| InChI | InChI=1S/C23H29N3O2/c27-22(19-9-5-2-6-10-19)20-15-21(24-16-20)23(28)26-13-11-25(12-14-26)17-18-7-3-1-4-8-18/h1,3-4,7-8,15-16,19,24H,2,5-6,9-14,17H2/p+1 |
| InChIKey | RGVGBGYBRWUYHC-UHFFFAOYSA-O |
| XLogP | 2.32 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.51 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |