C24H26N3O2+ — CID 9445986
benzhydryl-[2-oxo-2-[5-(pyrrolidine-1-carbonyl)-1H-pyrrol-3-yl]ethyl]azanium (PubChem CID 9445986) has the molecular formula C24H26N3O2+ and a molecular weight of 388.49 g/mol. Its IUPAC name is benzhydryl-[2-oxo-2-[5-(pyrrolidine-1-carbonyl)-1H-pyrrol-3-yl]ethyl]azanium.
| Compound Name | benzhydryl-[2-oxo-2-[5-(pyrrolidine-1-carbonyl)-1H-pyrrol-3-yl]ethyl]azanium |
|---|---|
| PubChem CID | 9445986 |
| Molecular Formula | C24H26N3O2+ |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | benzhydryl-[2-oxo-2-[5-(pyrrolidine-1-carbonyl)-1H-pyrrol-3-yl]ethyl]azanium |
| SMILES | O=C(C[NH2+]C(c1ccccc1)c1ccccc1)c1c[nH]c(C(=O)N2CCCC2)c1 |
| InChI | InChI=1S/C24H25N3O2/c28-22(20-15-21(25-16-20)24(29)27-13-7-8-14-27)17-26-23(18-9-3-1-4-10-18)19-11-5-2-6-12-19/h1-6,9-12,15-16,23,25-26H,7-8,13-14,17H2/p+1 |
| InChIKey | NOLSLUBDJLVYSL-UHFFFAOYSA-O |
| XLogP | 2.79 |
| TPSA | 69.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |