C21H27N4O2+ — CID 9250313
2-(4-phenylpiperazin-1-ium-1-yl)-1-[5-(pyrrolidine-1-carbonyl)-1H-pyrrol-3-yl]ethanone (PubChem CID 9250313) has the molecular formula C21H27N4O2+ and a molecular weight of 367.47 g/mol. Its IUPAC name is 2-(4-phenylpiperazin-1-ium-1-yl)-1-[5-(pyrrolidine-1-carbonyl)-1H-pyrrol-3-yl]ethanone.
| Compound Name | 2-(4-phenylpiperazin-1-ium-1-yl)-1-[5-(pyrrolidine-1-carbonyl)-1H-pyrrol-3-yl]ethanone |
|---|---|
| PubChem CID | 9250313 |
| Molecular Formula | C21H27N4O2+ |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.21 |
| IUPAC Name | 2-(4-phenylpiperazin-1-ium-1-yl)-1-[5-(pyrrolidine-1-carbonyl)-1H-pyrrol-3-yl]ethanone |
| SMILES | O=C(C[NH+]1CCN(c2ccccc2)CC1)c1c[nH]c(C(=O)N2CCCC2)c1 |
| InChI | InChI=1S/C21H26N4O2/c26-20(17-14-19(22-15-17)21(27)25-8-4-5-9-25)16-23-10-12-24(13-11-23)18-6-2-1-3-7-18/h1-3,6-7,14-15,22H,4-5,8-13,16H2/p+1 |
| InChIKey | ROMGRGUEFBNBQM-UHFFFAOYSA-O |
| XLogP | 0.84 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |