C18H19BrN2O2S — CID 55436712
2-[(2-bromophenyl)methylsulfanyl]-1-[5-(pyrrolidine-1-carbonyl)-1H-pyrrol-3-yl]ethanone (PubChem CID 55436712) has the molecular formula C18H19BrN2O2S and a molecular weight of 407.33 g/mol. Its IUPAC name is 2-[(2-bromophenyl)methylsulfanyl]-1-[5-(pyrrolidine-1-carbonyl)-1H-pyrrol-3-yl]ethanone.
| Compound Name | 2-[(2-bromophenyl)methylsulfanyl]-1-[5-(pyrrolidine-1-carbonyl)-1H-pyrrol-3-yl]ethanone |
|---|---|
| PubChem CID | 55436712 |
| Molecular Formula | C18H19BrN2O2S |
| Molecular Weight | 407.33 g/mol |
| Exact Mass | 406.04 |
| IUPAC Name | 2-[(2-bromophenyl)methylsulfanyl]-1-[5-(pyrrolidine-1-carbonyl)-1H-pyrrol-3-yl]ethanone |
| SMILES | O=C(CSCc1ccccc1Br)c1c[nH]c(C(=O)N2CCCC2)c1 |
| InChI | InChI=1S/C18H19BrN2O2S/c19-15-6-2-1-5-13(15)11-24-12-17(22)14-9-16(20-10-14)18(23)21-7-3-4-8-21/h1-2,5-6,9-10,20H,3-4,7-8,11-12H2 |
| InChIKey | JREDNBOIHQEFKY-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.33 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |