C21H28N2O2S — CID 9478177
2-(1-adamantylsulfanyl)-1-[5-(pyrrolidine-1-carbonyl)-1H-pyrrol-3-yl]ethanone (PubChem CID 9478177) has the molecular formula C21H28N2O2S and a molecular weight of 372.53 g/mol. Its IUPAC name is 2-(1-adamantylsulfanyl)-1-[5-(pyrrolidine-1-carbonyl)-1H-pyrrol-3-yl]ethanone.
| Compound Name | 2-(1-adamantylsulfanyl)-1-[5-(pyrrolidine-1-carbonyl)-1H-pyrrol-3-yl]ethanone |
|---|---|
| PubChem CID | 9478177 |
| Molecular Formula | C21H28N2O2S |
| Molecular Weight | 372.53 g/mol |
| Exact Mass | 372.19 |
| IUPAC Name | 2-(1-adamantylsulfanyl)-1-[5-(pyrrolidine-1-carbonyl)-1H-pyrrol-3-yl]ethanone |
| SMILES | O=C(CSC12CC3CC(CC(C3)C1)C2)c1c[nH]c(C(=O)N2CCCC2)c1 |
| InChI | InChI=1S/C21H28N2O2S/c24-19(17-8-18(22-12-17)20(25)23-3-1-2-4-23)13-26-21-9-14-5-15(10-21)7-16(6-14)11-21/h8,12,14-16,22H,1-7,9-11,13H2 |
| InChIKey | TWSSRDJPLNVFHP-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.53 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |