C23H36N3O+ — CID 1423531
[(3R)-1-(1-benzylpiperidin-1-ium-4-yl)piperidin-3-yl]-piperidin-1-ylmethanone (PubChem CID 1423531) has the molecular formula C23H36N3O+ and a molecular weight of 370.56 g/mol. Its IUPAC name is [(3R)-1-(1-benzylpiperidin-1-ium-4-yl)piperidin-3-yl]-piperidin-1-ylmethanone.
| Compound Name | [(3R)-1-(1-benzylpiperidin-1-ium-4-yl)piperidin-3-yl]-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 1423531 |
| Molecular Formula | C23H36N3O+ |
| Molecular Weight | 370.56 g/mol |
| Exact Mass | 370.29 |
| IUPAC Name | [(3R)-1-(1-benzylpiperidin-1-ium-4-yl)piperidin-3-yl]-piperidin-1-ylmethanone |
| SMILES | O=C([C@@H]1CCCN(C2CC[NH+](Cc3ccccc3)CC2)C1)N1CCCCC1 |
| InChI | InChI=1S/C23H35N3O/c27-23(25-13-5-2-6-14-25)21-10-7-15-26(19-21)22-11-16-24(17-12-22)18-20-8-3-1-4-9-20/h1,3-4,8-9,21-22H,2,5-7,10-19H2/p+1/t21-/m1/s1 |
| InChIKey | QROKWTDNZKOYDG-OAQYLSRUSA-O |
| XLogP | 1.96 |
| TPSA | 27.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.56 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |