C22H39N3O5 — CID 44663480
azepan-1-yl-[1-(1-propylpiperidin-1-ium-4-yl)piperidin-3-yl]methanone;2-hydroxy-2-oxoacetate (PubChem CID 44663480) has the molecular formula C22H39N3O5 and a molecular weight of 425.57 g/mol. Its IUPAC name is azepan-1-yl-[1-(1-propylpiperidin-1-ium-4-yl)piperidin-3-yl]methanone;2-hydroxy-2-oxoacetate.
| Compound Name | azepan-1-yl-[1-(1-propylpiperidin-1-ium-4-yl)piperidin-3-yl]methanone;2-hydroxy-2-oxoacetate |
|---|---|
| PubChem CID | 44663480 |
| Molecular Formula | C22H39N3O5 |
| Molecular Weight | 425.57 g/mol |
| Exact Mass | 425.29 |
| IUPAC Name | azepan-1-yl-[1-(1-propylpiperidin-1-ium-4-yl)piperidin-3-yl]methanone;2-hydroxy-2-oxoacetate |
| SMILES | CCC[NH+]1CCC(N2CCCC(C(=O)N3CCCCCC3)C2)CC1.O=C([O-])C(=O)O |
| InChI | InChI=1S/C20H37N3O.C2H2O4/c1-2-11-21-15-9-19(10-16-21)23-14-7-8-18(17-23)20(24)22-12-5-3-4-6-13-22;3-1(4)2(5)6/h18-19H,2-17H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | OTLMVJXTBDIPND-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 105.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.57 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|