C21H23N4O3+ — CID 9338760
3-[2-(4-benzylpiperazin-4-ium-1-yl)-2-oxoethyl]-2H-phthalazine-1,4-dione (PubChem CID 9338760) has the molecular formula C21H23N4O3+ and a molecular weight of 379.44 g/mol. Its IUPAC name is 3-[2-(4-benzylpiperazin-4-ium-1-yl)-2-oxoethyl]-2H-phthalazine-1,4-dione.
| Compound Name | 3-[2-(4-benzylpiperazin-4-ium-1-yl)-2-oxoethyl]-2H-phthalazine-1,4-dione |
|---|---|
| PubChem CID | 9338760 |
| Molecular Formula | C21H23N4O3+ |
| Molecular Weight | 379.44 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | 3-[2-(4-benzylpiperazin-4-ium-1-yl)-2-oxoethyl]-2H-phthalazine-1,4-dione |
| SMILES | O=C(Cn1[nH]c(=O)c2ccccc2c1=O)N1CC[NH+](Cc2ccccc2)CC1 |
| InChI | InChI=1S/C21H22N4O3/c26-19(15-25-21(28)18-9-5-4-8-17(18)20(27)22-25)24-12-10-23(11-13-24)14-16-6-2-1-3-7-16/h1-9H,10-15H2,(H,22,27)/p+1 |
| InChIKey | OSJWWNAXQMNUID-UHFFFAOYSA-O |
| XLogP | -0.38 |
| TPSA | 79.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.44 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |