C16H19FN4O3 — CID 110703473
4-[2-[4-(4-fluorophenyl)piperazin-1-yl]-2-oxoethyl]-1-methylpyrazolidine-3,5-dione (PubChem CID 110703473) has the molecular formula C16H19FN4O3 and a molecular weight of 334.35 g/mol. Its IUPAC name is 4-[2-[4-(4-fluorophenyl)piperazin-1-yl]-2-oxoethyl]-1-methylpyrazolidine-3,5-dione.
| Compound Name | 4-[2-[4-(4-fluorophenyl)piperazin-1-yl]-2-oxoethyl]-1-methylpyrazolidine-3,5-dione |
|---|---|
| PubChem CID | 110703473 |
| Molecular Formula | C16H19FN4O3 |
| Molecular Weight | 334.35 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | 4-[2-[4-(4-fluorophenyl)piperazin-1-yl]-2-oxoethyl]-1-methylpyrazolidine-3,5-dione |
| SMILES | CN1NC(=O)C(CC(=O)N2CCN(c3ccc(F)cc3)CC2)C1=O |
| InChI | InChI=1S/C16H19FN4O3/c1-19-16(24)13(15(23)18-19)10-14(22)21-8-6-20(7-9-21)12-4-2-11(17)3-5-12/h2-5,13H,6-10H2,1H3,(H,18,23) |
| InChIKey | RENWOLVKMMZNGJ-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.35 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_B(12)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|