C22H36N4O2 — CID 57443139
1-(4-butan-2-ylpiperazin-1-yl)-2-[4-(4-methoxyphenyl)-3-methylpiperazin-1-yl]ethanone (PubChem CID 57443139) has the molecular formula C22H36N4O2 and a molecular weight of 388.56 g/mol. Its IUPAC name is 1-(4-butan-2-ylpiperazin-1-yl)-2-[4-(4-methoxyphenyl)-3-methylpiperazin-1-yl]ethanone.
| Compound Name | 1-(4-butan-2-ylpiperazin-1-yl)-2-[4-(4-methoxyphenyl)-3-methylpiperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 57443139 |
| Molecular Formula | C22H36N4O2 |
| Molecular Weight | 388.56 g/mol |
| Exact Mass | 388.28 |
| IUPAC Name | 1-(4-butan-2-ylpiperazin-1-yl)-2-[4-(4-methoxyphenyl)-3-methylpiperazin-1-yl]ethanone |
| SMILES | CCC(C)N1CCN(C(=O)CN2CCN(c3ccc(OC)cc3)C(C)C2)CC1 |
| InChI | InChI=1S/C22H36N4O2/c1-5-18(2)24-11-13-25(14-12-24)22(27)17-23-10-15-26(19(3)16-23)20-6-8-21(28-4)9-7-20/h6-9,18-19H,5,10-17H2,1-4H3 |
| InChIKey | UUUSPOZHAYJWDC-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 39.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.56 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|