C22H34N2O2 — CID 58747950
1-[4-[4-[1-[(2S)-butan-2-yl]piperidin-4-yl]oxypiperidin-1-yl]phenyl]ethanone (PubChem CID 58747950) has the molecular formula C22H34N2O2 and a molecular weight of 358.53 g/mol. Its IUPAC name is 1-[4-[4-[1-[(2S)-butan-2-yl]piperidin-4-yl]oxypiperidin-1-yl]phenyl]ethanone.
| Compound Name | 1-[4-[4-[1-[(2S)-butan-2-yl]piperidin-4-yl]oxypiperidin-1-yl]phenyl]ethanone |
|---|---|
| PubChem CID | 58747950 |
| Molecular Formula | C22H34N2O2 |
| Molecular Weight | 358.53 g/mol |
| Exact Mass | 358.26 |
| IUPAC Name | 1-[4-[4-[1-[(2S)-butan-2-yl]piperidin-4-yl]oxypiperidin-1-yl]phenyl]ethanone |
| SMILES | CC[C@H](C)N1CCC(OC2CCN(c3ccc(C(C)=O)cc3)CC2)CC1 |
| InChI | InChI=1S/C22H34N2O2/c1-4-17(2)23-13-9-21(10-14-23)26-22-11-15-24(16-12-22)20-7-5-19(6-8-20)18(3)25/h5-8,17,21-22H,4,9-16H2,1-3H3/t17-/m0/s1 |
| InChIKey | OFSOWRWVXOGACO-KRWDZBQOSA-N |
| XLogP | 4.14 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.53 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |