C20H26N2O5 — CID 7691261
[(2S)-1-(4-ethylphenyl)-1-oxopropan-2-yl] 2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)acetate (PubChem CID 7691261) has the molecular formula C20H26N2O5 and a molecular weight of 374.44 g/mol. Its IUPAC name is [(2S)-1-(4-ethylphenyl)-1-oxopropan-2-yl] 2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)acetate.
| Compound Name | [(2S)-1-(4-ethylphenyl)-1-oxopropan-2-yl] 2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)acetate |
|---|---|
| PubChem CID | 7691261 |
| Molecular Formula | C20H26N2O5 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | [(2S)-1-(4-ethylphenyl)-1-oxopropan-2-yl] 2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)acetate |
| SMILES | CCc1ccc(C(=O)[C@H](C)OC(=O)CN2C(=O)NC(CC)(CC)C2=O)cc1 |
| InChI | InChI=1S/C20H26N2O5/c1-5-14-8-10-15(11-9-14)17(24)13(4)27-16(23)12-22-18(25)20(6-2,7-3)21-19(22)26/h8-11,13H,5-7,12H2,1-4H3,(H,21,26)/t13-/m0/s1 |
| InChIKey | HXSHPOITVCVSCH-ZDUSSCGKSA-N |
| XLogP | 2.47 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|